cas: 161024-80-2 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-3-phenylpropanoic acid, 97% (CAS 161024-80-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: BLDpharm, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD18679-100mg |
| cas | 161024-80-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 425.43 Pln | |
| BLDpharm | 25g | 1763.85 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 555.03 Pln | |
| Fluorochem | 25g | 1179.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 161024-80-2) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: JTNQFJPZRTURSI-LLVKDONJSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | JTNQFJPZRTURSI-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)