cas: 851307-12-5 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-4-(2,4-difluorophenyl)butanoic acid, 95% (CAS 851307-12-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690765-100MG |
| cas | 851307-12-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 250mg | 1185.02 Pln | |
| Fluorochem | 1g | 3043.74 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-4-(2,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 851307-12-5) is a chemical compound with the molecular formula C15H19F2NO4 and a molecular weight of 315.31 g/mol. IUPAC name: (3R)-4-(2,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LUYHWLQWAVCDNA-LLVKDONJSA-N.
| Molecular formula | C15H19F2NO4 |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | (3R)-4-(2,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LUYHWLQWAVCDNA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=C(C=C(C=C1)F)F)CC(=O)O |
Computed by PubChem (NCBI)