cas: 262429-49-2 — see every product listed under this CAS number, including other names
(R)-3-(3-Chlorophenyl)-beta-alanine, 96% (CAS 262429-49-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317945-250MG |
| cas | 262429-49-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 435.28 Pln | |
| Fluorochem | 5g | 1268.32 Pln | |
| Fluorochem | 10g | 2262.76 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-amino-3-(3-chlorophenyl)propanoic acid (CAS 262429-49-2) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3R)-3-amino-3-(3-chlorophenyl)propanoic acid. InChIKey: LIDRHPCWOYOBIZ-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3R)-3-amino-3-(3-chlorophenyl)propanoic acid |
| InChIKey | LIDRHPCWOYOBIZ-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)