CAS 262429-49-2 appears in our catalog under these names: (R)-3-Amino-3-(3-chloro-phenyl)-propionic acid, 96%, H-D-β-Phe(3-Cl)-OH 98%, (R)-3-Amino-3-(3-chlorophenyl)propionic acid, 97%, 97%, (R)-3-(3-Chlorophenyl)-beta-alanine, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
(3R)-3-amino-3-(3-chlorophenyl)propanoic acid (CAS 262429-49-2) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3R)-3-amino-3-(3-chlorophenyl)propanoic acid. InChIKey: LIDRHPCWOYOBIZ-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3R)-3-amino-3-(3-chlorophenyl)propanoic acid |
| InChIKey | LIDRHPCWOYOBIZ-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)