CAS 774178-18-6 appears in our catalog under these names: (S)-3-Amino-3-(3-chloro-phenyl)-propionic acid, 97%, (S)–3–Amino–3–(3–chlorophenyl)propanoic acid, H-β-Phe(3-Cl)-OH 97%, (S)-3-Amino-3-(3-chlorophenyl)propanoic acid, 97%, 97%, (S)-beta-(3-Chlorophenyl)alanine, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
(3S)-3-amino-3-(3-chlorophenyl)propanoic acid (CAS 774178-18-6) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3S)-3-amino-3-(3-chlorophenyl)propanoic acid. InChIKey: LIDRHPCWOYOBIZ-QMMMGPOBSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-chlorophenyl)propanoic acid |
| InChIKey | LIDRHPCWOYOBIZ-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)