cas: 144744-41-2 — see every product listed under this CAS number, including other names
(R)-Amino-(4-fluoro-phenyl)-acetic acid, HCl, 97%, 97% (CAS 144744-41-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112K4O-250mg |
| cas | 144744-41-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1245.20 Pln | |
| Chemat | 10g | 1835.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride (CAS 144744-41-2) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: (2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride. InChIKey: AAUCORGIJVVECX-OGFXRTJISA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride |
| InChIKey | AAUCORGIJVVECX-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)