CAS 144744-41-2 appears in our catalog under these names: (R)-Amino-(4-fluoro-phenyl)-acetic acid hydrochloride, 97%, (R)-Amino-(4-fluoro-phenyl)-acetic acid, HCl, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g.
(2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride (CAS 144744-41-2) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: (2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride. InChIKey: AAUCORGIJVVECX-OGFXRTJISA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride |
| InChIKey | AAUCORGIJVVECX-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)