H-D-Phg(4-F)-OH HCl 97%
cas: 144744-41-2 — see every product listed under this CAS number, including other names
H-D-Phg(4-F)-OH HCl 97% (CAS 144744-41-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105161-250mg |
| cas | 144744-41-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1560.75 Pln | |
| Ambeed | 10g | 2311.69 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A105161 |
(2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride (CAS 144744-41-2) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: (2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride. InChIKey: AAUCORGIJVVECX-OGFXRTJISA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride |
| InChIKey | AAUCORGIJVVECX-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-Amino-2-(4-fluorophenyl)acetic acid hydrochloride, (2R)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride, (R)-Amino-(4-fluoro-phenyl)-acetic acid, HCl, (R)-4-Fluorophenylglycine hydrochloride, D-4-Fluorophenylglycine hydrochloride, (2R)-2-amino-2-(4-fluorophenyl)acetic acid,hydrochloride, (2R)-Amino(4-fluorophenyl)acetic acid--hydrogen chloride (1/1)