Products 185994-15-4
CAS 185994-15-4 is the registry number for (S)-Amino-(4-fluoro-phenyl)-acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2S)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride (CAS 185994-15-4) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: (2S)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride. InChIKey: AAUCORGIJVVECX-FJXQXJEOSA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride |
| InChIKey | AAUCORGIJVVECX-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-P-FLUOROPHENYLGLYCINE HCL, (2S)-2-amino-2-(4-fluorophenyl)acetic acid;hydrochloride, (S)-Amino-(4-fluoro-phenyl)-acetic acid, HCl, (S)-2-Amino-2-(4-fluorophenyl)aceticacidhydrochloride, L-p-Fluorophenylglycine HCl (H-L-Phg(4-F)-OH.HCl), (2S)-Amino(4-fluorophenyl)acetic acid--hydrogen chloride (1/1)