CAS 709665-70-3 appears in our catalog under these names: (2-Fluorophenyl)glycine hydrochloride, 95%, 2-Amino-2-(2-fluorophenyl)acetic acid hydrochloride, 98%, 2-Amino-2-(2-fluorophenyl)acetic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g.
2-amino-2-(2-fluorophenyl)acetic acid;hydrochloride (CAS 709665-70-3) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: 2-amino-2-(2-fluorophenyl)acetic acid;hydrochloride. InChIKey: OHMMIUFKFKTOOW-UHFFFAOYSA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | 2-amino-2-(2-fluorophenyl)acetic acid;hydrochloride |
| InChIKey | OHMMIUFKFKTOOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)