CAS 1063733-13-0 appears in our catalog under these names: Methyl 4-amino-2-fluorobenzoate hydrochloride, 95%, Methyl 4-amino-2-fluorobenzoate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 2,5g, 0,25g.
Methyl 4-amino-2-fluorobenzoate;hydrochloride (CAS 1063733-13-0) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: methyl 4-amino-2-fluorobenzoate;hydrochloride. InChIKey: PJSVMBDABLWZAJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | methyl 4-amino-2-fluorobenzoate;hydrochloride |
| InChIKey | PJSVMBDABLWZAJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)F.Cl |
Computed by PubChem (NCBI)