cas: 1373232-19-9 — see every product listed under this CAS number, including other names
(R)-BENZYL 2-METHYL-3-OXOPIPERAZINE-1-CARBOXYLATE, 95% (CAS 1373232-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386247-100MG |
| cas | 1373232-19-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 1419.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate (CAS 1373232-19-9) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate. InChIKey: QGOPZRYPDFSHOY-SNVBAGLBSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate |
| InChIKey | QGOPZRYPDFSHOY-SNVBAGLBSA-N |
| SMILES | C[C@@H]1C(=O)NCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)