CAS 220615-80-5 is the registry number for 3-(4-Methoxybenzyl)-5,5-dimethylimidazolidine-2,4-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(4-methoxyphenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione (CAS 220615-80-5) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: 3-[(4-methoxyphenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione. InChIKey: WIEMNXSYXMUNOG-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 3-[(4-methoxyphenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione |
| InChIKey | WIEMNXSYXMUNOG-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CC2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)