cas: 179747-84-3 — see every product listed under this CAS number, including other names
(R)-Benzyl (2,5-dioxopyrrolidin-3-yl)carbamate 97% (CAS 179747-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391629-250mg |
| cas | 179747-84-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1388.31 Pln | |
| Ambeed | 5g | 3769.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A391629 |
Benzyl N-[(3R)-2,5-dioxopyrrolidin-3-yl]carbamate (CAS 179747-84-3) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: benzyl N-[(3R)-2,5-dioxopyrrolidin-3-yl]carbamate. InChIKey: QRQMHYISDDHZBY-SECBINFHSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | benzyl N-[(3R)-2,5-dioxopyrrolidin-3-yl]carbamate |
| InChIKey | QRQMHYISDDHZBY-SECBINFHSA-N |
| SMILES | C1[C@H](C(=O)NC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)