CAS 25063-68-7 appears in our catalog under these names: 2,2-Dimethyl-5-((pyridin-3-ylamino)methylene)-1,3-dioxane-4,6-dione, 95%, 2,2-Dimethyl-5-((pyridin-3-ylamino)methylene)-1,3-dioxane-4,6-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
2,2-dimethyl-5-[(pyridin-3-ylamino)methylidene]-1,3-dioxane-4,6-dione (CAS 25063-68-7) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 2,2-dimethyl-5-[(pyridin-3-ylamino)methylidene]-1,3-dioxane-4,6-dione. InChIKey: QZUHCJHZZJYTGE-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 2,2-dimethyl-5-[(pyridin-3-ylamino)methylidene]-1,3-dioxane-4,6-dione |
| InChIKey | QZUHCJHZZJYTGE-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CN=CC=C2)C(=O)O1)C |
Computed by PubChem (NCBI)