CAS 879996-77-7 is the registry number for 3-(3,4-Dimethoxyphenyl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxylic acid (CAS 879996-77-7) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: BPEKIIXCDLHWRC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | BPEKIIXCDLHWRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C=NN2)C(=O)O)OC |
Computed by PubChem (NCBI)