Products 951923-68-5
CAS 951923-68-5 appears in our catalog under these names: 3,5-Dimethyl-4-[(4-nitrophenoxy)methyl]isoxazole, 95%, 3,5-Dimethyl-4-((4-nitrophenoxy)methyl)isoxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3,5-dimethyl-4-[(4-nitrophenoxy)methyl]-1,2-oxazole (CAS 951923-68-5) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 3,5-dimethyl-4-[(4-nitrophenoxy)methyl]-1,2-oxazole. InChIKey: PLTZVEHLSDYCCQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 3,5-dimethyl-4-[(4-nitrophenoxy)methyl]-1,2-oxazole |
| InChIKey | PLTZVEHLSDYCCQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)