CAS 26332-10-5 is the registry number for 5-(1,3-Benzodioxol-5-ylmethyl)-5-methylimidazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-(1,3-benzodioxol-5-ylmethyl)-5-methylimidazolidine-2,4-dione (CAS 26332-10-5) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-ylmethyl)-5-methylimidazolidine-2,4-dione. InChIKey: GLRYEKZAKBJMNV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-ylmethyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | GLRYEKZAKBJMNV-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)CC2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)