CAS 1146290-27-8 appears in our catalog under these names: 4-(2-Hydroxyethyl)-5-oxo-1-phenyl-4,5-dihydro-1h-pyrazole-3-carboxylic acid, 95%, 4-(2-Hydroxyethyl)-5-oxo-1-phenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-(2-hydroxyethyl)-5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid (CAS 1146290-27-8) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 4-(2-hydroxyethyl)-5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid. InChIKey: RECYHGJQIKPRDX-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 4-(2-hydroxyethyl)-5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid |
| InChIKey | RECYHGJQIKPRDX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(C(=N2)C(=O)O)CCO |
Computed by PubChem (NCBI)