cas: 98167-06-7 — see every product listed under this CAS number, including other names
(R)-Indoline-2-carboxylic acid (CAS 98167-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209343-250MG |
| cas | 98167-06-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 737.26 Pln | |
| Fluorochem | 10g | 1216.26 Pln | |
| Fluorochem | 25g | 2424.16 Pln |
| delivery time | 3-4 weeks |
|---|
(2R)-2,3-dihydro-1H-indole-2-carboxylic acid (CAS 98167-06-7) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (2R)-2,3-dihydro-1H-indole-2-carboxylic acid. InChIKey: QNRXNRGSOJZINA-MRVPVSSYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R)-2,3-dihydro-1H-indole-2-carboxylic acid |
| InChIKey | QNRXNRGSOJZINA-MRVPVSSYSA-N |
| SMILES | C1[C@@H](NC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)