cas: 98167-06-7 — see every product listed under this CAS number, including other names
(R)-Indoline-2-carboxylic acid 95% (CAS 98167-06-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A488298-1g |
| cas | 98167-06-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 726.38 Pln | |
| Ambeed | 25g | 1432.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A488298 |
(2R)-2,3-dihydro-1H-indole-2-carboxylic acid (CAS 98167-06-7) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (2R)-2,3-dihydro-1H-indole-2-carboxylic acid. InChIKey: QNRXNRGSOJZINA-MRVPVSSYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R)-2,3-dihydro-1H-indole-2-carboxylic acid |
| InChIKey | QNRXNRGSOJZINA-MRVPVSSYSA-N |
| SMILES | C1[C@@H](NC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)