cas: 845909-40-2 — see every product listed under this CAS number, including other names
(R)-Methyl 3-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 95%, 95% (CAS 845909-40-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDPS-250mg |
| cas | 845909-40-2 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 909.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (3R)-3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride (CAS 845909-40-2) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl (3R)-3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride. InChIKey: ISRJRRVWAPZDPY-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | ISRJRRVWAPZDPY-SBSPUUFOSA-N |
| SMILES | COC(=O)C[C@H](C1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)