CAS 845909-40-2 appears in our catalog under these names: (R)-Methyl 3-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 95%, (R)–Methyl 3–amino–3–(3–hydroxyphenyl)propanoate hydrochloride, (R)-Methyl 3-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Methyl (3R)-3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride (CAS 845909-40-2) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl (3R)-3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride. InChIKey: ISRJRRVWAPZDPY-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | ISRJRRVWAPZDPY-SBSPUUFOSA-N |
| SMILES | COC(=O)C[C@H](C1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)