cas: 955979-06-3 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-isopropylpiperazine-1-carboxylate hydrochloride 95% (CAS 955979-06-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A737801-100mg |
| cas | 955979-06-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 904.38 Pln | |
| Ambeed | 5g | 3401.94 Pln | |
| Ambeed | 10g | 5120.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A737801 |
Tert-butyl (2R)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride (CAS 955979-06-3) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl (2R)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride. InChIKey: ILEMLVIGGJLCHC-PPHPATTJSA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl (2R)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | ILEMLVIGGJLCHC-PPHPATTJSA-N |
| SMILES | CC(C)[C@@H]1CNCCN1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)