Products 1203011-26-0

CAS 1203011-26-0 is the registry number for 1-N-Boc-2-isopropylpiperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-propan-2-ylpiperazine-1-carboxylate;hydrochloride (CAS 1203011-26-0) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl 2-propan-2-ylpiperazine-1-carboxylate;hydrochloride. InChIKey: ILEMLVIGGJLCHC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H25ClN2O2
Molecular weight264.79 g/mol
IUPAC nametert-butyl 2-propan-2-ylpiperazine-1-carboxylate;hydrochloride
InChIKeyILEMLVIGGJLCHC-UHFFFAOYSA-N
SMILESCC(C)C1CNCCN1C(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)