cas: 774178-18-6 — see every product listed under this CAS number, including other names
(S)–3–Amino–3–(3–chlorophenyl)propanoic acid (CAS 774178-18-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF48723-100mg |
| cas | 774178-18-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 536.19 Pln | |
| GLPBio | 1g | 840.43 Pln | |
| GLPBio | 250mg | 601.72 Pln | |
| GLPBio | 5g | 1907.58 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-3-amino-3-(3-chlorophenyl)propanoic acid (CAS 774178-18-6) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3S)-3-amino-3-(3-chlorophenyl)propanoic acid. InChIKey: LIDRHPCWOYOBIZ-QMMMGPOBSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-chlorophenyl)propanoic acid |
| InChIKey | LIDRHPCWOYOBIZ-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)