cas: 774178-18-6 — see every product listed under this CAS number, including other names
(S)-beta-(3-Chlorophenyl)alanine, 97% (CAS 774178-18-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040516-250MG |
| cas | 774178-18-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1507.82 Pln | |
| Fluorochem | 10g | 2715.73 Pln | |
| Fluorochem | 25g | 6703.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-amino-3-(3-chlorophenyl)propanoic acid (CAS 774178-18-6) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3S)-3-amino-3-(3-chlorophenyl)propanoic acid. InChIKey: LIDRHPCWOYOBIZ-QMMMGPOBSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-chlorophenyl)propanoic acid |
| InChIKey | LIDRHPCWOYOBIZ-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)