Products 1154281-08-9
CAS 1154281-08-9 is the registry number for Methyl (S)-2-(5-chlorofuran-2-carboxamido)-2-methylpentanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-[(5-chlorofuran-2-carbonyl)amino]-2-methylpentanoate (CAS 1154281-08-9) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: methyl (2S)-2-[(5-chlorofuran-2-carbonyl)amino]-2-methylpentanoate. InChIKey: DAYQKVUZHXTGCU-LBPRGKRZSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | methyl (2S)-2-[(5-chlorofuran-2-carbonyl)amino]-2-methylpentanoate |
| InChIKey | DAYQKVUZHXTGCU-LBPRGKRZSA-N |
| SMILES | CCC[C@@](C)(C(=O)OC)NC(=O)C1=CC=C(O1)Cl |
Computed by PubChem (NCBI)