CAS 103954-23-0 is the registry number for ((R)-1-carboxyethyl)-L-phenylalanine hydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
(2S)-2-[[(1R)-1-carboxyethyl]amino]-3-phenylpropanoic acid;hydrochloride (CAS 103954-23-0) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: (2S)-2-[[(1R)-1-carboxyethyl]amino]-3-phenylpropanoic acid;hydrochloride. InChIKey: BPUVMMXNTHPOJN-SCYNACPDSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | (2S)-2-[[(1R)-1-carboxyethyl]amino]-3-phenylpropanoic acid;hydrochloride |
| InChIKey | BPUVMMXNTHPOJN-SCYNACPDSA-N |
| SMILES | C[C@H](C(=O)O)N[C@@H](CC1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)