CAS 866083-20-7 is the registry number for Ethyl (S)-3-amino-3-(benzo[d][1,3]dioxol-5-yl)propanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3S)-3-amino-3-(1,3-benzodioxol-5-yl)propanoate;hydrochloride (CAS 866083-20-7) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: ethyl (3S)-3-amino-3-(1,3-benzodioxol-5-yl)propanoate;hydrochloride. InChIKey: NKQHQIJWIYNEIX-FVGYRXGTSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | ethyl (3S)-3-amino-3-(1,3-benzodioxol-5-yl)propanoate;hydrochloride |
| InChIKey | NKQHQIJWIYNEIX-FVGYRXGTSA-N |
| SMILES | CCOC(=O)C[C@@H](C1=CC2=C(C=C1)OCO2)N.Cl |
Computed by PubChem (NCBI)