(S)-1-((Benzyloxy)carbonyl)piperidine-3-carboxylic acid, 97%, 97%
cas: 88466-74-4 — see every product listed under this CAS number, including other names
(S)-1-((Benzyloxy)carbonyl)piperidine-3-carboxylic acid, 97%, 97% (CAS 88466-74-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115C9F-10g |
| cas | 88466-74-4 |
| size | 10g |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 410.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 890.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 88466-74-4) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: (3S)-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: FFLPIVZNYJKKDM-LBPRGKRZSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | (3S)-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | FFLPIVZNYJKKDM-LBPRGKRZSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-1-((Benzyloxy)carbonyl)piperidine-3-carboxylic acid, (s)-1-cbz-piperidine-3-carboxylic acid, L-1-Cbz-Nipecotic acid, (s)-piperidine-1,3-dicarboxylic acid 1-benzyl ester, (3S)-1-Benzyloxycarbonylpiperidine-3-carboxylic acid, (3S)-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid, 1-Cbz-(3S)-3-piperidinecarboxylic acid, 1-n-cbz-piperidine-3(s)-carboxylic acid, (3S)-1-[(benzyloxy)carbonyl]piperidine-3-carboxylic acid, (S)-1-[(Benzyloxy)carbonyl]piperidine-3-carboxylic Acid