CAS 220064-81-3 is the registry number for tert-Butyl (4R)-2-oxo-4-phenyl-1,3-oxazolidine-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Tert-butyl (4R)-2-oxo-4-phenyl-1,3-oxazolidine-3-carboxylate (CAS 220064-81-3) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: tert-butyl (4R)-2-oxo-4-phenyl-1,3-oxazolidine-3-carboxylate. InChIKey: DSJJLADJHWAWFB-NSHDSACASA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | tert-butyl (4R)-2-oxo-4-phenyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | DSJJLADJHWAWFB-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)