cas: 64838-55-7 — see every product listed under this CAS number, including other names
(S)-1-((S)-3-(Acetylthio)-2-methylpropanoyl)pyrrolidine-2-carboxylic acid, 90% (CAS 64838-55-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243135-1G |
| cas | 64838-55-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 25g | 6058.30 Pln | |
| Fluorochem | 100g | 20948.89 Pln |
| purity | 90% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 64838-55-7) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: ZNQRGUYIKSRYCI-APPZFPTMSA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ZNQRGUYIKSRYCI-APPZFPTMSA-N |
| SMILES | C[C@H](CSC(=O)C)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)