cas: 64838-55-7 — see every product listed under this CAS number, including other names
Captopril EP Impurity J, 90% (CAS 64838-55-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A202492-250mg |
| cas | 64838-55-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 428.05 Pln | |
| AmBeed | 1g | 603.82 Pln |
| purity | 90% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 64838-55-7) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: ZNQRGUYIKSRYCI-APPZFPTMSA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ZNQRGUYIKSRYCI-APPZFPTMSA-N |
| SMILES | C[C@H](CSC(=O)C)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)