cas: 64838-55-7 — see every product listed under this CAS number, including other names
1-[(2S)-3-(Acetylthio)-2-methyl-1-oxopropyl]-L-proline (CAS 64838-55-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BOQ-1g |
| cas | 64838-55-7 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 606.80 Pln | |
| Chemat | 25g | 2022.80 Pln | |
| Chemat | 100g | 5550.80 Pln |
| delivery time | 3 weeks |
|---|
(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 64838-55-7) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: ZNQRGUYIKSRYCI-APPZFPTMSA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ZNQRGUYIKSRYCI-APPZFPTMSA-N |
| SMILES | C[C@H](CSC(=O)C)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)