CAS 1187386-33-9 appears in our catalog under these names: N-Methyl 2-bromo-5-(trifluoromethyl)aniline hydrochloride, 98%, 2-Bromo-N-methyl-5-(trifluoromethyl)aniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
2-bromo-N-methyl-5-(trifluoromethyl)aniline;hydrochloride (CAS 1187386-33-9) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 2-bromo-N-methyl-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: ZRYZQFUHSMTCDR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 2-bromo-N-methyl-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | ZRYZQFUHSMTCDR-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1)C(F)(F)F)Br.Cl |
Computed by PubChem (NCBI)