Products 2155856-59-8
CAS 2155856-59-8 appears in our catalog under these names: (3-Bromo-5-trifluoromethyl-phenyl)-methyl-amine hydrochloride, 95%, 3-Bromo-N-methyl-5-(trifluoromethyl)aniline hydrochloride, 98%, 3-Bromo-N-methyl-5-(trifluoromethyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
3-bromo-N-methyl-5-(trifluoromethyl)aniline;hydrochloride (CAS 2155856-59-8) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 3-bromo-N-methyl-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: BSMSWFFVKHDUIG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 3-bromo-N-methyl-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | BSMSWFFVKHDUIG-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=CC(=C1)C(F)(F)F)Br.Cl |
Computed by PubChem (NCBI)