(S)-1-(4-(Methylsulfonyl)phenyl)ethanamine hydrochloride, 97%
cas: 1212202-62-4 — see every product listed under this CAS number, including other names
(S)-1-(4-(Methylsulfonyl)phenyl)ethanamine hydrochloride, 97% (CAS 1212202-62-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A372315-100mg |
| cas | 1212202-62-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 704.12 Pln | |
| Ambeed | 250mg | 1076.81 Pln | |
| Ambeed | 1g | 2717.75 Pln | |
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 933.20 Pln | |
| Chemat | 1g | 2320.40 Pln | |
| BLDpharm | 100mg | 753.09 Pln | |
| BLDpharm | 250mg | 1152.95 Pln | |
| BLDpharm | 1g | 2924.55 Pln | |
| Fluorochem | 100mg | 1117.33 Pln | |
| Fluorochem | 250mg | 1716.08 Pln | |
| Fluorochem | 1g | 4298.50 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(1S)-1-(4-methylsulfonylphenyl)ethanamine;hydrochloride (CAS 1212202-62-4) is a chemical compound with the molecular formula C9H14ClNO2S and a molecular weight of 235.73 g/mol. IUPAC name: (1S)-1-(4-methylsulfonylphenyl)ethanamine;hydrochloride. InChIKey: JAECXGZNWPVNEU-FJXQXJEOSA-N.
| Molecular formula | C9H14ClNO2S |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | (1S)-1-(4-methylsulfonylphenyl)ethanamine;hydrochloride |
| InChIKey | JAECXGZNWPVNEU-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1S)-1-(4-methanesulfonylphenyl)ethan-1-amine hydrochloride, (S)-1-(4-(Methylsulfonyl)phenyl)ethanamine hydrochloride, (1S)-1-(4-methylsulfonylphenyl)ethanamine;hydrochloride, (1S)-1-(4-Methanesulfonylphenyl)ethan-1-amine HCl, (S)-1-(4-(Methylsulfonyl)phenyl)ethanaminehydrochloride, (S)-1-(4-(methylsulfonyl)phenyl)ethan-1-amine hydrochloride