CAS 98959-89-8 appears in our catalog under these names: 1-(4-(ethanesulfonyl)phenyl)methanamine hydrochloride, [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride 95%, [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride, 95%, 95%, [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
(4-ethylsulfonylphenyl)methanamine;hydrochloride (CAS 98959-89-8) is a chemical compound with the molecular formula C9H14ClNO2S and a molecular weight of 235.73 g/mol. IUPAC name: (4-ethylsulfonylphenyl)methanamine;hydrochloride. InChIKey: KXPRDHZTUZNMQT-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2S |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | (4-ethylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | KXPRDHZTUZNMQT-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)