cas: 778565-93-8 — see every product listed under this CAS number, including other names
(S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97% (CAS 778565-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229404-100MG |
| cas | 778565-93-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 1096.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine (CAS 778565-93-8) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZUFCCCNTJRQNCF-ZETCQYMHSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZUFCCCNTJRQNCF-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)Br |
Computed by PubChem (NCBI)