CAS 843608-53-7 appears in our catalog under these names: (R)–1–(4–Bromophenyl)–2,2,2–trifluoroethanamine, (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97%, 97%, (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 2.5g.
(1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine (CAS 843608-53-7) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZUFCCCNTJRQNCF-SSDOTTSWSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZUFCCCNTJRQNCF-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)N)Br |
Computed by PubChem (NCBI)