cas: 1213181-44-2 — see every product listed under this CAS number, including other names
(S)-1-(4-Fluoro-3-methylphenyl)ethanamine hydrochloride, 97% (CAS 1213181-44-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239323-250MG |
| cas | 1213181-44-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1356.83 Pln | |
| Fluorochem | 100mg | 820.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride (CAS 1213181-44-2) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1S)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride. InChIKey: HZEFSEOLAJTAQO-FJXQXJEOSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1S)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | HZEFSEOLAJTAQO-FJXQXJEOSA-N |
| SMILES | CC1=C(C=CC(=C1)[C@H](C)N)F.Cl |
Computed by PubChem (NCBI)