cas: 1241725-73-4 — see every product listed under this CAS number, including other names
(S)-1-BOc-2-isopropyl-piperazine hcl, 96% (CAS 1241725-73-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690585-100MG |
| cas | 1241725-73-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 1252.70 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride (CAS 1241725-73-4) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl (2S)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride. InChIKey: ILEMLVIGGJLCHC-HNCPQSOCSA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl (2S)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | ILEMLVIGGJLCHC-HNCPQSOCSA-N |
| SMILES | CC(C)[C@H]1CNCCN1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)