cas: 31795-93-4 — see every product listed under this CAS number, including other names
(S)-1-Benzylpyrrolidine-2-carboxylic acid, 96%, 96% (CAS 31795-93-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYO5-250mg |
| cas | 31795-93-4 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 342.80 Pln | |
| Chemat | 50g | 616.40 Pln | |
| Chemat | 100g | 1168.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-benzylpyrrolidine-2-carboxylic acid (CAS 31795-93-4) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (2S)-1-benzylpyrrolidine-2-carboxylic acid. InChIKey: XNROFTAJEGCDCT-NSHDSACASA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (2S)-1-benzylpyrrolidine-2-carboxylic acid |
| InChIKey | XNROFTAJEGCDCT-NSHDSACASA-N |
| SMILES | C1C[C@H](N(C1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)