CAS 31795-93-4 appears in our catalog under these names: N-Benzyl-(S)-proline, N–Benzyl–L–proline, Bzl-L-Pro-OH, Bzl-L-Pro-OH, >95.0%(GC), (S)-1-Benzylpyrrolidine-2-carboxylic acid, 96%, 96%. Offered by: TRC, GLPBio, Iris Biotech, TCI, Chemat. Available pack sizes: 1g, 2g, 5g, 100g, 10g, 25g, 250mg, 50g.
(2S)-1-benzylpyrrolidine-2-carboxylic acid (CAS 31795-93-4) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (2S)-1-benzylpyrrolidine-2-carboxylic acid. InChIKey: XNROFTAJEGCDCT-NSHDSACASA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (2S)-1-benzylpyrrolidine-2-carboxylic acid |
| InChIKey | XNROFTAJEGCDCT-NSHDSACASA-N |
| SMILES | C1C[C@H](N(C1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)