cas: 573704-57-1 — see every product listed under this CAS number, including other names
(S)-1-Cbz-3-pyrrolidinecarboxamide, 95+% (CAS 573704-57-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A453703-5g |
| cas | 573704-57-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5909.47 Pln | |
| AmBeed | 10g | 8448.37 Pln | |
| AmBeed | 25g | 16826.74 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl (3S)-3-carbamoylpyrrolidine-1-carboxylate (CAS 573704-57-1) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl (3S)-3-carbamoylpyrrolidine-1-carboxylate. InChIKey: RFMDNYSGEQPCAA-NSHDSACASA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl (3S)-3-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | RFMDNYSGEQPCAA-NSHDSACASA-N |
| SMILES | C1CN(C[C@H]1C(=O)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)