CAS 1217835-98-7 is the registry number for (R)-Benzyl 3-carbamoylpyrrolidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 5g.
Benzyl (3R)-3-carbamoylpyrrolidine-1-carboxylate (CAS 1217835-98-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl (3R)-3-carbamoylpyrrolidine-1-carboxylate. InChIKey: RFMDNYSGEQPCAA-LLVKDONJSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl (3R)-3-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | RFMDNYSGEQPCAA-LLVKDONJSA-N |
| SMILES | C1CN(C[C@@H]1C(=O)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)