cas: 2227804-07-9 — see every product listed under this CAS number, including other names
(S)-1-Mesitylethanamine hydrochloride, 98% (CAS 2227804-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546799-100MG |
| cas | 2227804-07-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1424.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride (CAS 2227804-07-9) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride. InChIKey: VFBGENMGPYITQS-PPHPATTJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride |
| InChIKey | VFBGENMGPYITQS-PPHPATTJSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[C@H](C)N)C.Cl |
Computed by PubChem (NCBI)