Products 1032153-84-6
CAS 1032153-84-6 appears in our catalog under these names: (R)-1-Mesitylethanamine hydrochloride, 98%, 98%, (1R)-1-(2,4,6-TRIMETHYLPHENYL)ETHAN-1-AMINE HYDROCHLORIDE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride (CAS 1032153-84-6) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1R)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride. InChIKey: VFBGENMGPYITQS-HNCPQSOCSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1R)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride |
| InChIKey | VFBGENMGPYITQS-HNCPQSOCSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[C@@H](C)N)C.Cl |
Computed by PubChem (NCBI)