cas: 83548-46-3 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 2-methyl 2,3-dihydro-1H-pyrrole-1,2-dicarboxylate, 98% (CAS 83548-46-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A338038-10g |
| cas | 83548-46-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 14287.84 Pln | |
| AmBeed | 5g | 8363.74 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-tert-butyl 2-O-methyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate (CAS 83548-46-3) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate. InChIKey: WGCPPYJWSDCBNC-QMMMGPOBSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | WGCPPYJWSDCBNC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)